C20H19N5O4 — CID 137354795
2-methoxyethyl N-[6-(8-methyl-4-oxo-3H-phthalazin-1-yl)-1H-benzimidazol-2-yl]carbamate (PubChem CID 137354795) has the molecular formula C20H19N5O4 and a molecular weight of 393.40 g/mol. Its IUPAC name is 2-methoxyethyl N-[6-(8-methyl-4-oxo-3H-phthalazin-1-yl)-1H-benzimidazol-2-yl]carbamate.
| Compound Name | 2-methoxyethyl N-[6-(8-methyl-4-oxo-3H-phthalazin-1-yl)-1H-benzimidazol-2-yl]carbamate |
|---|---|
| PubChem CID | 137354795 |
| Molecular Formula | C20H19N5O4 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 2-methoxyethyl N-[6-(8-methyl-4-oxo-3H-phthalazin-1-yl)-1H-benzimidazol-2-yl]carbamate |
| SMILES | COCCOC(=O)Nc1nc2ccc(-c3n[nH]c(=O)c4cccc(C)c34)cc2[nH]1 |
| InChI | InChI=1S/C20H19N5O4/c1-11-4-3-5-13-16(11)17(24-25-18(13)26)12-6-7-14-15(10-12)22-19(21-14)23-20(27)29-9-8-28-2/h3-7,10H,8-9H2,1-2H3,(H,25,26)(H2,21,22,23,27) |
| InChIKey | PUTOAVCVCZZHAG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|