C18H14FN5O3 — CID 137354653
ethyl-[6-(8-fluoro-4-oxo-3H-phthalazin-1-yl)-1H-benzimidazol-2-yl]carbamic acid (PubChem CID 137354653) has the molecular formula C18H14FN5O3 and a molecular weight of 367.34 g/mol. Its IUPAC name is ethyl-[6-(8-fluoro-4-oxo-3H-phthalazin-1-yl)-1H-benzimidazol-2-yl]carbamic acid.
| Compound Name | ethyl-[6-(8-fluoro-4-oxo-3H-phthalazin-1-yl)-1H-benzimidazol-2-yl]carbamic acid |
|---|---|
| PubChem CID | 137354653 |
| Molecular Formula | C18H14FN5O3 |
| Molecular Weight | 367.34 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | ethyl-[6-(8-fluoro-4-oxo-3H-phthalazin-1-yl)-1H-benzimidazol-2-yl]carbamic acid |
| SMILES | CCN(C(=O)O)c1nc2ccc(-c3n[nH]c(=O)c4cccc(F)c34)cc2[nH]1 |
| InChI | InChI=1S/C18H14FN5O3/c1-2-24(18(26)27)17-20-12-7-6-9(8-13(12)21-17)15-14-10(16(25)23-22-15)4-3-5-11(14)19/h3-8H,2H2,1H3,(H,20,21)(H,23,25)(H,26,27) |
| InChIKey | WKPOQJRTSLRXQX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 114.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |