About [6-[2,4-difluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-1H-benzimidazol-2-yl] carbamate
[6-[2,4-difluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-1H-benzimidazol-2-yl] carbamate (PubChem CID 175274514) has the molecular formula C23H15F2N5O3
and a molecular weight of 447.40 g/mol. Its IUPAC name is [6-[2,4-difluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-1H-benzimidazol-2-yl] carbamate.
Molecular Properties
| Compound Name | [6-[2,4-difluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-1H-benzimidazol-2-yl] carbamate |
| PubChem CID | 175274514 |
| Molecular Formula | C23H15F2N5O3 |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | [6-[2,4-difluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-1H-benzimidazol-2-yl] carbamate |
| SMILES | NC(=O)Oc1nc2ccc(-c3cc(Cc4n[nH]c(=O)c5ccccc45)c(F)cc3F)cc2[nH]1 |
| InChI | InChI=1S/C23H15F2N5O3/c24-16-10-17(25)15(11-5-6-18-20(8-11)28-23(27-18)33-22(26)32)7-12(16)9-19-13-3-1-2-4-14(13)21(31)30-29-19/h1-8,10H,9H2,(H2,26,32)(H,27,28)(H,30,31) |
| InChIKey | ZAIZUMUAJJUHGQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 126.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [6-[2,4-difluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-1H-benzimidazol-2-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[2,4-difluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-1H-benzimidazol-2-yl] carbamate?
The IUPAC name of [6-[2,4-difluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-1H-benzimidazol-2-yl] carbamate (CID 175274514) is [6-[2,4-difluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-1H-benzimidazol-2-yl] carbamate.
What is the SMILES notation for [6-[2,4-difluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-1H-benzimidazol-2-yl] carbamate?
The canonical SMILES for [6-[2,4-difluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-1H-benzimidazol-2-yl] carbamate is NC(=O)Oc1nc2ccc(-c3cc(Cc4n[nH]c(=O)c5ccccc45)c(F)cc3F)cc2[nH]1.
What is the InChIKey of [6-[2,4-difluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-1H-benzimidazol-2-yl] carbamate?
The InChIKey is ZAIZUMUAJJUHGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15F2N5O3/c24-16-10-17(25)15(11-5-6-18-20(8-11)28-23(27-18)33-22(26)32)7-12(16)9-19-13-3-1-2-4-14(13)21(31)30-29-19/h1-8,10H,9H2,(H2,26,32)(H,27,28)(H,30,31).
What are the key properties of [6-[2,4-difluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-1H-benzimidazol-2-yl] carbamate?
[6-[2,4-difluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-1H-benzimidazol-2-yl] carbamate has a molecular weight of 447.40 g/mol, XLogP of 3.79, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[2,4-difluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-1H-benzimidazol-2-yl] carbamate is sourced from PubChem (CID 175274514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).