C29H27F2N3O2 — CID 137355161
4-[5-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl)-2-[2-fluoro-4-(2-methoxyethyl)phenyl]phenyl]-2-fluorobenzonitrile (PubChem CID 137355161) has the molecular formula C29H27F2N3O2 and a molecular weight of 487.55 g/mol. Its IUPAC name is 4-[5-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl)-2-[2-fluoro-4-(2-methoxyethyl)phenyl]phenyl]-2-fluorobenzonitrile.
| Compound Name | 4-[5-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl)-2-[2-fluoro-4-(2-methoxyethyl)phenyl]phenyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 137355161 |
| Molecular Formula | C29H27F2N3O2 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | 4-[5-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl)-2-[2-fluoro-4-(2-methoxyethyl)phenyl]phenyl]-2-fluorobenzonitrile |
| SMILES | COCCc1ccc(-c2ccc(C(=O)N3CC4CNCC4C3)cc2-c2ccc(C#N)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C29H27F2N3O2/c1-36-9-8-18-2-6-25(28(31)10-18)24-7-5-20(29(35)34-16-22-14-33-15-23(22)17-34)11-26(24)19-3-4-21(13-32)27(30)12-19/h2-7,10-12,22-23,33H,8-9,14-17H2,1H3 |
| InChIKey | NOKLAVKEVBOUHL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |