C22H18N2O10 — CID 137356946
5-[[3-carboxy-4-(3-oxobutanoyloxy)phenyl]diazenyl]-2-(3-oxobutanoyloxy)benzoic acid (PubChem CID 137356946) has the molecular formula C22H18N2O10 and a molecular weight of 470.39 g/mol. Its IUPAC name is 5-[[3-carboxy-4-(3-oxobutanoyloxy)phenyl]diazenyl]-2-(3-oxobutanoyloxy)benzoic acid.
| Compound Name | 5-[[3-carboxy-4-(3-oxobutanoyloxy)phenyl]diazenyl]-2-(3-oxobutanoyloxy)benzoic acid |
|---|---|
| PubChem CID | 137356946 |
| Molecular Formula | C22H18N2O10 |
| Molecular Weight | 470.39 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 5-[[3-carboxy-4-(3-oxobutanoyloxy)phenyl]diazenyl]-2-(3-oxobutanoyloxy)benzoic acid |
| SMILES | CC(=O)CC(=O)Oc1ccc(/N=N/c2ccc(OC(=O)CC(C)=O)c(C(=O)O)c2)cc1C(=O)O |
| InChI | InChI=1S/C22H18N2O10/c1-11(25)7-19(27)33-17-5-3-13(9-15(17)21(29)30)23-24-14-4-6-18(16(10-14)22(31)32)34-20(28)8-12(2)26/h3-6,9-10H,7-8H2,1-2H3,(H,29,30)(H,31,32)/b24-23+ |
| InChIKey | DIPUBOPGLYHDLF-WCWDXBQESA-N |
| XLogP | 3.27 |
| TPSA | 186.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|