C34H32FN5O — CID 137357014
8-[4-[1-[[(E)-4-fluoronon-2-en-8-ynyl]amino]cyclobutyl]phenyl]-9-phenyl-2H-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-3-one (PubChem CID 137357014) has the molecular formula C34H32FN5O and a molecular weight of 545.66 g/mol. Its IUPAC name is 8-[4-[1-[[(E)-4-fluoronon-2-en-8-ynyl]amino]cyclobutyl]phenyl]-9-phenyl-2H-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-3-one.
| Compound Name | 8-[4-[1-[[(E)-4-fluoronon-2-en-8-ynyl]amino]cyclobutyl]phenyl]-9-phenyl-2H-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-3-one |
|---|---|
| PubChem CID | 137357014 |
| Molecular Formula | C34H32FN5O |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | 8-[4-[1-[[(E)-4-fluoronon-2-en-8-ynyl]amino]cyclobutyl]phenyl]-9-phenyl-2H-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-3-one |
| SMILES | C#CCCCC(F)/C=C/CNC1(c2ccc(-c3nc4ccn5c(=O)[nH]nc5c4cc3-c3ccccc3)cc2)CCC1 |
| InChI | InChI=1S/C34H32FN5O/c1-2-3-5-12-27(35)13-8-21-36-34(19-9-20-34)26-16-14-25(15-17-26)31-28(24-10-6-4-7-11-24)23-29-30(37-31)18-22-40-32(29)38-39-33(40)41/h1,4,6-8,10-11,13-18,22-23,27,36H,3,5,9,12,19-21H2,(H,39,41)/b13-8+ |
| InChIKey | FLKFAQNRXROBCB-MDWZMJQESA-N |
| XLogP | 6.57 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|