C34H32ClN5O2 — CID 146546652
(E)-N-[1-[4-(3-oxo-9-phenyl-2H-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-7-ium-8-yl)phenyl]cyclobutyl]non-2-en-8-ynamide chloride (PubChem CID 146546652) has the molecular formula C34H32ClN5O2 and a molecular weight of 578.12 g/mol. Its IUPAC name is (E)-N-[1-[4-(3-oxo-9-phenyl-2H-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-7-ium-8-yl)phenyl]cyclobutyl]non-2-en-8-ynamide chloride.
| Compound Name | (E)-N-[1-[4-(3-oxo-9-phenyl-2H-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-7-ium-8-yl)phenyl]cyclobutyl]non-2-en-8-ynamide chloride |
|---|---|
| PubChem CID | 146546652 |
| Molecular Formula | C34H32ClN5O2 |
| Molecular Weight | 578.12 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | (E)-N-[1-[4-(3-oxo-9-phenyl-2H-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-7-ium-8-yl)phenyl]cyclobutyl]non-2-en-8-ynamide chloride |
| SMILES | C#CCCCC/C=C/C(=O)NC1(c2ccc(-c3[nH+]c4ccn5c(=O)[nH]nc5c4cc3-c3ccccc3)cc2)CCC1.[Cl-] |
| InChI | InChI=1S/C34H31N5O2.ClH/c1-2-3-4-5-6-10-14-30(40)36-34(20-11-21-34)26-17-15-25(16-18-26)31-27(24-12-8-7-9-13-24)23-28-29(35-31)19-22-39-32(28)37-38-33(39)41;/h1,7-10,12-19,22-23H,3-6,11,20-21H2,(H,36,40)(H,38,41);1H/b14-10+; |
| InChIKey | OROJRPPRRXWBGW-KMZJGFRYSA-N |
| XLogP | 2.57 |
| TPSA | 93.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.12 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|