C20H20N6O3S2 — CID 137358415
(4-nitrophenyl)-[3-[[5-(pyrimidin-5-ylmethylsulfanyl)-1,3-thiazol-2-yl]amino]piperidin-1-yl]methanone (PubChem CID 137358415) has the molecular formula C20H20N6O3S2 and a molecular weight of 456.55 g/mol. Its IUPAC name is (4-nitrophenyl)-[3-[[5-(pyrimidin-5-ylmethylsulfanyl)-1,3-thiazol-2-yl]amino]piperidin-1-yl]methanone.
| Compound Name | (4-nitrophenyl)-[3-[[5-(pyrimidin-5-ylmethylsulfanyl)-1,3-thiazol-2-yl]amino]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 137358415 |
| Molecular Formula | C20H20N6O3S2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | (4-nitrophenyl)-[3-[[5-(pyrimidin-5-ylmethylsulfanyl)-1,3-thiazol-2-yl]amino]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)N1CCCC(Nc2ncc(SCc3cncnc3)s2)C1 |
| InChI | InChI=1S/C20H20N6O3S2/c27-19(15-3-5-17(6-4-15)26(28)29)25-7-1-2-16(11-25)24-20-23-10-18(31-20)30-12-14-8-21-13-22-9-14/h3-6,8-10,13,16H,1-2,7,11-12H2,(H,23,24) |
| InChIKey | CDZITIUFVRHASB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|