C20H22N6OS2 — CID 137358549
(4-aminophenyl)-[(3R)-3-[[5-(pyrimidin-5-ylmethylsulfanyl)-1,3-thiazol-2-yl]amino]piperidin-1-yl]methanone (PubChem CID 137358549) has the molecular formula C20H22N6OS2 and a molecular weight of 426.57 g/mol. Its IUPAC name is (4-aminophenyl)-[(3R)-3-[[5-(pyrimidin-5-ylmethylsulfanyl)-1,3-thiazol-2-yl]amino]piperidin-1-yl]methanone.
| Compound Name | (4-aminophenyl)-[(3R)-3-[[5-(pyrimidin-5-ylmethylsulfanyl)-1,3-thiazol-2-yl]amino]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 137358549 |
| Molecular Formula | C20H22N6OS2 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | (4-aminophenyl)-[(3R)-3-[[5-(pyrimidin-5-ylmethylsulfanyl)-1,3-thiazol-2-yl]amino]piperidin-1-yl]methanone |
| SMILES | Nc1ccc(C(=O)N2CCC[C@@H](Nc3ncc(SCc4cncnc4)s3)C2)cc1 |
| InChI | InChI=1S/C20H22N6OS2/c21-16-5-3-15(4-6-16)19(27)26-7-1-2-17(11-26)25-20-24-10-18(29-20)28-12-14-8-22-13-23-9-14/h3-6,8-10,13,17H,1-2,7,11-12,21H2,(H,24,25)/t17-/m1/s1 |
| InChIKey | BUYGDNRJUCIHBK-QGZVFWFLSA-N |
| XLogP | 3.52 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|