C22H29N6O2S2+ — CID 162781834
(4-aminopyridin-1-ium-1-yl)-[(3S)-3-[[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]amino]piperidin-1-yl]methanone (PubChem CID 162781834) has the molecular formula C22H29N6O2S2+ and a molecular weight of 473.65 g/mol. Its IUPAC name is (4-aminopyridin-1-ium-1-yl)-[(3S)-3-[[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]amino]piperidin-1-yl]methanone.
| Compound Name | (4-aminopyridin-1-ium-1-yl)-[(3S)-3-[[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]amino]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 162781834 |
| Molecular Formula | C22H29N6O2S2+ |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | (4-aminopyridin-1-ium-1-yl)-[(3S)-3-[[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]amino]piperidin-1-yl]methanone |
| SMILES | CC(C)(C)c1cnc(CSc2cnc(N[C@H]3CCCN(C(=O)[n+]4ccc(N)cc4)C3)s2)o1 |
| InChI | InChI=1S/C22H28N6O2S2/c1-22(2,3)17-11-24-18(30-17)14-31-19-12-25-20(32-19)26-16-5-4-8-28(13-16)21(29)27-9-6-15(23)7-10-27/h6-7,9-12,16,23H,4-5,8,13-14H2,1-3H3,(H,25,26)/p+1/t16-/m0/s1 |
| InChIKey | SDAQLAPPVVPHTM-INIZCTEOSA-O |
| XLogP | 4.14 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|