C26H31N9O4S — CID 137358435
5-tert-butyl-N-[(5S)-8-[2-[(5-methyl-1H-pyrazol-4-yl)amino]pyrimidin-4-yl]-3-methylsulfonyl-1,2,4,5-tetrahydro-3-benzazepin-5-yl]-1,3,4-oxadiazole-2-carboxamide (PubChem CID 137358435) has the molecular formula C26H31N9O4S and a molecular weight of 565.66 g/mol. Its IUPAC name is 5-tert-butyl-N-[(5S)-8-[2-[(5-methyl-1H-pyrazol-4-yl)amino]pyrimidin-4-yl]-3-methylsulfonyl-1,2,4,5-tetrahydro-3-benzazepin-5-yl]-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | 5-tert-butyl-N-[(5S)-8-[2-[(5-methyl-1H-pyrazol-4-yl)amino]pyrimidin-4-yl]-3-methylsulfonyl-1,2,4,5-tetrahydro-3-benzazepin-5-yl]-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 137358435 |
| Molecular Formula | C26H31N9O4S |
| Molecular Weight | 565.66 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | 5-tert-butyl-N-[(5S)-8-[2-[(5-methyl-1H-pyrazol-4-yl)amino]pyrimidin-4-yl]-3-methylsulfonyl-1,2,4,5-tetrahydro-3-benzazepin-5-yl]-1,3,4-oxadiazole-2-carboxamide |
| SMILES | Cc1[nH]ncc1Nc1nccc(-c2ccc3c(c2)CCN(S(C)(=O)=O)C[C@H]3NC(=O)c2nnc(C(C)(C)C)o2)n1 |
| InChI | InChI=1S/C26H31N9O4S/c1-15-20(13-28-32-15)31-25-27-10-8-19(30-25)17-6-7-18-16(12-17)9-11-35(40(5,37)38)14-21(18)29-22(36)23-33-34-24(39-23)26(2,3)4/h6-8,10,12-13,21H,9,11,14H2,1-5H3,(H,28,32)(H,29,36)(H,27,30,31)/t21-/m1/s1 |
| InChIKey | HZJUHLCNSOFQLF-OAQYLSRUSA-N |
| XLogP | 2.89 |
| TPSA | 171.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.66 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |