C26H30N8O2 — CID 137358060
5-tert-butyl-N-[2-[2-[(5-methyl-1H-pyrazol-4-yl)amino]pyrimidin-4-yl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]-1,2,4-oxadiazole-3-carboxamide (PubChem CID 137358060) has the molecular formula C26H30N8O2 and a molecular weight of 486.58 g/mol. Its IUPAC name is 5-tert-butyl-N-[2-[2-[(5-methyl-1H-pyrazol-4-yl)amino]pyrimidin-4-yl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | 5-tert-butyl-N-[2-[2-[(5-methyl-1H-pyrazol-4-yl)amino]pyrimidin-4-yl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 137358060 |
| Molecular Formula | C26H30N8O2 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 5-tert-butyl-N-[2-[2-[(5-methyl-1H-pyrazol-4-yl)amino]pyrimidin-4-yl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]-1,2,4-oxadiazole-3-carboxamide |
| SMILES | Cc1[nH]ncc1Nc1nccc(-c2ccc3c(c2)CCCCC3NC(=O)c2noc(C(C)(C)C)n2)n1 |
| InChI | InChI=1S/C26H30N8O2/c1-15-21(14-28-33-15)31-25-27-12-11-19(30-25)17-9-10-18-16(13-17)7-5-6-8-20(18)29-23(35)22-32-24(36-34-22)26(2,3)4/h9-14,20H,5-8H2,1-4H3,(H,28,33)(H,29,35)(H,27,30,31) |
| InChIKey | LEABDAOEJJDSBC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 134.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |