C25H29N9O2 — CID 151849988
5-tert-butyl-N-[2-[4-[(1-methylpyrazol-4-yl)amino]-1,3,5-triazin-2-yl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]-1,2,4-oxadiazole-3-carboxamide (PubChem CID 151849988) has the molecular formula C25H29N9O2 and a molecular weight of 487.57 g/mol. Its IUPAC name is 5-tert-butyl-N-[2-[4-[(1-methylpyrazol-4-yl)amino]-1,3,5-triazin-2-yl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | 5-tert-butyl-N-[2-[4-[(1-methylpyrazol-4-yl)amino]-1,3,5-triazin-2-yl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 151849988 |
| Molecular Formula | C25H29N9O2 |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | 5-tert-butyl-N-[2-[4-[(1-methylpyrazol-4-yl)amino]-1,3,5-triazin-2-yl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]-1,2,4-oxadiazole-3-carboxamide |
| SMILES | Cn1cc(Nc2ncnc(-c3ccc4c(c3)CCCCC4NC(=O)c3noc(C(C)(C)C)n3)n2)cn1 |
| InChI | InChI=1S/C25H29N9O2/c1-25(2,3)23-31-21(33-36-23)22(35)30-19-8-6-5-7-15-11-16(9-10-18(15)19)20-26-14-27-24(32-20)29-17-12-28-34(4)13-17/h9-14,19H,5-8H2,1-4H3,(H,30,35)(H,26,27,29,32) |
| InChIKey | SILQIYJJMKSPTI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |