C21H21F4NO3 — CID 137362029
3-cyclopentyloxy-4-fluoro-N-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 137362029) has the molecular formula C21H21F4NO3 and a molecular weight of 411.40 g/mol. Its IUPAC name is 3-cyclopentyloxy-4-fluoro-N-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | 3-cyclopentyloxy-4-fluoro-N-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 137362029 |
| Molecular Formula | C21H21F4NO3 |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 3-cyclopentyloxy-4-fluoro-N-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | COc1ccc(CNC(=O)c2ccc(F)c(OC3CCCC3)c2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H21F4NO3/c1-28-16-8-6-14(17(11-16)21(23,24)25)12-26-20(27)13-7-9-18(22)19(10-13)29-15-4-2-3-5-15/h6-11,15H,2-5,12H2,1H3,(H,26,27) |
| InChIKey | ITKBTQGYZFSJJY-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |