C17H17ClN6O2S — CID 137363976
3-(carbamoylamino)-5-[2-(2-chloropyrimidin-5-yl)ethynyl]-N-piperidin-3-ylthiophene-2-carboxamide (PubChem CID 137363976) has the molecular formula C17H17ClN6O2S and a molecular weight of 404.88 g/mol. Its IUPAC name is 3-(carbamoylamino)-5-[2-(2-chloropyrimidin-5-yl)ethynyl]-N-piperidin-3-ylthiophene-2-carboxamide.
| Compound Name | 3-(carbamoylamino)-5-[2-(2-chloropyrimidin-5-yl)ethynyl]-N-piperidin-3-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 137363976 |
| Molecular Formula | C17H17ClN6O2S |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 3-(carbamoylamino)-5-[2-(2-chloropyrimidin-5-yl)ethynyl]-N-piperidin-3-ylthiophene-2-carboxamide |
| SMILES | NC(=O)Nc1cc(C#Cc2cnc(Cl)nc2)sc1C(=O)NC1CCCNC1 |
| InChI | InChI=1S/C17H17ClN6O2S/c18-16-21-7-10(8-22-16)3-4-12-6-13(24-17(19)26)14(27-12)15(25)23-11-2-1-5-20-9-11/h6-8,11,20H,1-2,5,9H2,(H,23,25)(H3,19,24,26) |
| InChIKey | WPKYGXTVUVKJKQ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|