C17H19ClN4O3S — CID 87260220
5-(4-chlorophenyl)-3-(hydroxycarbamoylamino)-N-[(3S)-piperidin-3-yl]thiophene-2-carboxamide (PubChem CID 87260220) has the molecular formula C17H19ClN4O3S and a molecular weight of 394.88 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-(hydroxycarbamoylamino)-N-[(3S)-piperidin-3-yl]thiophene-2-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-3-(hydroxycarbamoylamino)-N-[(3S)-piperidin-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 87260220 |
| Molecular Formula | C17H19ClN4O3S |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 5-(4-chlorophenyl)-3-(hydroxycarbamoylamino)-N-[(3S)-piperidin-3-yl]thiophene-2-carboxamide |
| SMILES | O=C(NO)Nc1cc(-c2ccc(Cl)cc2)sc1C(=O)N[C@H]1CCCNC1 |
| InChI | InChI=1S/C17H19ClN4O3S/c18-11-5-3-10(4-6-11)14-8-13(21-17(24)22-25)15(26-14)16(23)20-12-2-1-7-19-9-12/h3-6,8,12,19,25H,1-2,7,9H2,(H,20,23)(H2,21,22,24)/t12-/m0/s1 |
| InChIKey | HYHAEOHTPVBODU-LBPRGKRZSA-N |
| XLogP | 3.06 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|