C21H34N4O8 — CID 137364472
2-[3-[2-[2-[[3-(2,5-dioxopyrrol-1-yl)-4,4-dimethylpentanoyl]amino]ethoxy]ethoxy]propanoylamino]ethyl carbamate (PubChem CID 137364472) has the molecular formula C21H34N4O8 and a molecular weight of 470.52 g/mol. Its IUPAC name is 2-[3-[2-[2-[[3-(2,5-dioxopyrrol-1-yl)-4,4-dimethylpentanoyl]amino]ethoxy]ethoxy]propanoylamino]ethyl carbamate.
| Compound Name | 2-[3-[2-[2-[[3-(2,5-dioxopyrrol-1-yl)-4,4-dimethylpentanoyl]amino]ethoxy]ethoxy]propanoylamino]ethyl carbamate |
|---|---|
| PubChem CID | 137364472 |
| Molecular Formula | C21H34N4O8 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 2-[3-[2-[2-[[3-(2,5-dioxopyrrol-1-yl)-4,4-dimethylpentanoyl]amino]ethoxy]ethoxy]propanoylamino]ethyl carbamate |
| SMILES | CC(C)(C)C(CC(=O)NCCOCCOCCC(=O)NCCOC(N)=O)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C21H34N4O8/c1-21(2,3)15(25-18(28)4-5-19(25)29)14-17(27)24-7-10-32-13-12-31-9-6-16(26)23-8-11-33-20(22)30/h4-5,15H,6-14H2,1-3H3,(H2,22,30)(H,23,26)(H,24,27) |
| InChIKey | HTOLPXLCEJUIHR-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 166.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|