C17H27N3O7 — CID 59378709
3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-[(2-methoxyacetyl)amino]ethoxy]ethoxy]ethyl]butanamide (PubChem CID 59378709) has the molecular formula C17H27N3O7 and a molecular weight of 385.42 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-[(2-methoxyacetyl)amino]ethoxy]ethoxy]ethyl]butanamide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-[(2-methoxyacetyl)amino]ethoxy]ethoxy]ethyl]butanamide |
|---|---|
| PubChem CID | 59378709 |
| Molecular Formula | C17H27N3O7 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-[(2-methoxyacetyl)amino]ethoxy]ethoxy]ethyl]butanamide |
| SMILES | COCC(=O)NCCOCCOCCNC(=O)CC(C)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C17H27N3O7/c1-13(20-16(23)3-4-17(20)24)11-14(21)18-5-7-26-9-10-27-8-6-19-15(22)12-25-2/h3-4,13H,5-12H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | PVJVMWUBKADDOU-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|