C17H17F3N4O4 — CID 137366662
N'-(oxolan-2-ylmethyl)-N'-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]oxamide (PubChem CID 137366662) has the molecular formula C17H17F3N4O4 and a molecular weight of 398.34 g/mol. Its IUPAC name is N'-(oxolan-2-ylmethyl)-N'-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]oxamide.
| Compound Name | N'-(oxolan-2-ylmethyl)-N'-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]oxamide |
|---|---|
| PubChem CID | 137366662 |
| Molecular Formula | C17H17F3N4O4 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | N'-(oxolan-2-ylmethyl)-N'-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]oxamide |
| SMILES | NC(=O)C(=O)N(Cc1ccc(-c2noc(C(F)(F)F)n2)cc1)CC1CCCO1 |
| InChI | InChI=1S/C17H17F3N4O4/c18-17(19,20)16-22-14(23-28-16)11-5-3-10(4-6-11)8-24(15(26)13(21)25)9-12-2-1-7-27-12/h3-6,12H,1-2,7-9H2,(H2,21,25) |
| InChIKey | LDVMJCAQDHCATE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|