C19H20F3N3O3 — CID 155768360
N-(oxolan-2-ylmethyl)-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]but-2-enamide (PubChem CID 155768360) has the molecular formula C19H20F3N3O3 and a molecular weight of 395.38 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]but-2-enamide.
| Compound Name | N-(oxolan-2-ylmethyl)-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]but-2-enamide |
|---|---|
| PubChem CID | 155768360 |
| Molecular Formula | C19H20F3N3O3 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]but-2-enamide |
| SMILES | CC=CC(=O)N(Cc1ccc(-c2noc(C(F)(F)F)n2)cc1)CC1CCCO1 |
| InChI | InChI=1S/C19H20F3N3O3/c1-2-4-16(26)25(12-15-5-3-10-27-15)11-13-6-8-14(9-7-13)17-23-18(28-24-17)19(20,21)22/h2,4,6-9,15H,3,5,10-12H2,1H3 |
| InChIKey | NYESOHOBUGIMCI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|