C21H15ClFN5O — CID 137368650
2-[[5-(2-chloro-4-methoxyphenyl)imidazo[1,2-a]pyridin-2-yl]methyl]-5-fluoro-1H-imidazo[4,5-b]pyridine (PubChem CID 137368650) has the molecular formula C21H15ClFN5O and a molecular weight of 407.84 g/mol. Its IUPAC name is 2-[[5-(2-chloro-4-methoxyphenyl)imidazo[1,2-a]pyridin-2-yl]methyl]-5-fluoro-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-[[5-(2-chloro-4-methoxyphenyl)imidazo[1,2-a]pyridin-2-yl]methyl]-5-fluoro-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 137368650 |
| Molecular Formula | C21H15ClFN5O |
| Molecular Weight | 407.84 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 2-[[5-(2-chloro-4-methoxyphenyl)imidazo[1,2-a]pyridin-2-yl]methyl]-5-fluoro-1H-imidazo[4,5-b]pyridine |
| SMILES | COc1ccc(-c2cccc3nc(Cc4nc5nc(F)ccc5[nH]4)cn23)c(Cl)c1 |
| InChI | InChI=1S/C21H15ClFN5O/c1-29-13-5-6-14(15(22)10-13)17-3-2-4-20-24-12(11-28(17)20)9-19-25-16-7-8-18(23)26-21(16)27-19/h2-8,10-11H,9H2,1H3,(H,25,26,27) |
| InChIKey | JKAMKWGDWZVBRR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.84 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|