C17H15ClN2O3S — CID 137368659
methyl 2-[8-(2-chloro-4-methoxyphenyl)-3-sulfanylideneimidazo[1,5-a]pyridin-2-yl]acetate (PubChem CID 137368659) has the molecular formula C17H15ClN2O3S and a molecular weight of 362.84 g/mol. Its IUPAC name is methyl 2-[8-(2-chloro-4-methoxyphenyl)-3-sulfanylideneimidazo[1,5-a]pyridin-2-yl]acetate.
| Compound Name | methyl 2-[8-(2-chloro-4-methoxyphenyl)-3-sulfanylideneimidazo[1,5-a]pyridin-2-yl]acetate |
|---|---|
| PubChem CID | 137368659 |
| Molecular Formula | C17H15ClN2O3S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | methyl 2-[8-(2-chloro-4-methoxyphenyl)-3-sulfanylideneimidazo[1,5-a]pyridin-2-yl]acetate |
| SMILES | COC(=O)Cn1cc2c(-c3ccc(OC)cc3Cl)cccn2c1=S |
| InChI | InChI=1S/C17H15ClN2O3S/c1-22-11-5-6-12(14(18)8-11)13-4-3-7-20-15(13)9-19(17(20)24)10-16(21)23-2/h3-9H,10H2,1-2H3 |
| InChIKey | DPVTWPIXUDGMNK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|