C83H53N9 — CID 137369097
9-[2,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-3-[3-(6-phenyl-2-pyridinyl)carbazol-9-yl]phenyl]-3,6-diphenylcarbazole (PubChem CID 137369097) has the molecular formula C83H53N9 and a molecular weight of 1176.40 g/mol. Its IUPAC name is 9-[2,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-3-[3-(6-phenyl-2-pyridinyl)carbazol-9-yl]phenyl]-3,6-diphenylcarbazole.
| Compound Name | 9-[2,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-3-[3-(6-phenyl-2-pyridinyl)carbazol-9-yl]phenyl]-3,6-diphenylcarbazole |
|---|---|
| PubChem CID | 137369097 |
| Molecular Formula | C83H53N9 |
| Molecular Weight | 1176.40 g/mol |
| Exact Mass | 1175.44 |
| IUPAC Name | 9-[2,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-3-[3-(6-phenyl-2-pyridinyl)carbazol-9-yl]phenyl]-3,6-diphenylcarbazole |
| SMILES | c1ccc(-c2ccc3c(c2)c2cc(-c4ccccc4)ccc2n3-c2c(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc(-n3c4ccccc4c4cc(-c5cccc(-c6ccccc6)n5)ccc43)c2-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C83H53N9/c1-8-25-54(26-9-1)61-43-47-73-67(51-61)68-52-62(55-27-10-2-11-28-55)44-48-74(68)92(73)77-65(82-87-78(57-31-14-4-15-32-57)85-79(88-82)58-33-16-5-17-34-58)46-50-75(76(77)83-89-80(59-35-18-6-19-36-59)86-81(90-83)60-37-20-7-21-38-60)91-71-42-23-22-39-64(71)66-53-63(45-49-72(66)91)70-41-24-40-69(84-70)56-29-12-3-13-30-56/h1-53H |
| InChIKey | DBXCYDOIIDNGCE-UHFFFAOYSA-N |
| XLogP | 20.32 |
| TPSA | 100.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 92 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1176.40 |
| LogP ≤ 5 | 20.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |