C69H44F6N4 — CID 137369133
4-[2,7-bis(trifluoromethyl)carbazol-9-yl]-3,5-diphenyl-2,6-bis[2-(N-phenylanilino)phenyl]benzonitrile (PubChem CID 137369133) has the molecular formula C69H44F6N4 and a molecular weight of 1043.13 g/mol. Its IUPAC name is 4-[2,7-bis(trifluoromethyl)carbazol-9-yl]-3,5-diphenyl-2,6-bis[2-(N-phenylanilino)phenyl]benzonitrile.
| Compound Name | 4-[2,7-bis(trifluoromethyl)carbazol-9-yl]-3,5-diphenyl-2,6-bis[2-(N-phenylanilino)phenyl]benzonitrile |
|---|---|
| PubChem CID | 137369133 |
| Molecular Formula | C69H44F6N4 |
| Molecular Weight | 1043.13 g/mol |
| Exact Mass | 1042.35 |
| IUPAC Name | 4-[2,7-bis(trifluoromethyl)carbazol-9-yl]-3,5-diphenyl-2,6-bis[2-(N-phenylanilino)phenyl]benzonitrile |
| SMILES | N#Cc1c(-c2ccccc2N(c2ccccc2)c2ccccc2)c(-c2ccccc2)c(-n2c3cc(C(F)(F)F)ccc3c3ccc(C(F)(F)F)cc32)c(-c2ccccc2)c1-c1ccccc1N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C69H44F6N4/c70-68(71,72)48-39-41-54-55-42-40-49(69(73,74)75)44-62(55)79(61(54)43-48)67-63(46-23-7-1-8-24-46)65(56-35-19-21-37-59(56)77(50-27-11-3-12-28-50)51-29-13-4-14-30-51)58(45-76)66(64(67)47-25-9-2-10-26-47)57-36-20-22-38-60(57)78(52-31-15-5-16-32-52)53-33-17-6-18-34-53/h1-44H |
| InChIKey | YURSHUUQLVYRDK-UHFFFAOYSA-N |
| XLogP | 20.30 |
| TPSA | 35.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1043.13 |
| LogP ≤ 5 | 20.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |