C19H22O7 — CID 137370413
(2R,3S,4S,5R)-2-(hydroxymethyl)-6-(1-hydroxytrideca-5,7,9,11-tetraynoxy)oxane-3,4,5-triol (PubChem CID 137370413) has the molecular formula C19H22O7 and a molecular weight of 362.38 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-(hydroxymethyl)-6-(1-hydroxytrideca-5,7,9,11-tetraynoxy)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-(1-hydroxytrideca-5,7,9,11-tetraynoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 137370413 |
| Molecular Formula | C19H22O7 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-(1-hydroxytrideca-5,7,9,11-tetraynoxy)oxane-3,4,5-triol |
| SMILES | CC#CC#CC#CC#CCCCC(O)OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C19H22O7/c1-2-3-4-5-6-7-8-9-10-11-12-15(21)26-19-18(24)17(23)16(22)14(13-20)25-19/h14-24H,10-13H2,1H3/t14-,15?,16-,17+,18-,19?/m1/s1 |
| InChIKey | DMDQAWOEKIWGNM-QJBNJHTDSA-N |
| XLogP | -1.67 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|