C26H31F4N3O4 — CID 137370540
2-[4-[cyclohexyl(2-methylpropyl)amino]-3-[[3-fluoro-4-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]acetic acid (PubChem CID 137370540) has the molecular formula C26H31F4N3O4 and a molecular weight of 525.54 g/mol. Its IUPAC name is 2-[4-[cyclohexyl(2-methylpropyl)amino]-3-[[3-fluoro-4-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]acetic acid.
| Compound Name | 2-[4-[cyclohexyl(2-methylpropyl)amino]-3-[[3-fluoro-4-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 137370540 |
| Molecular Formula | C26H31F4N3O4 |
| Molecular Weight | 525.54 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | 2-[4-[cyclohexyl(2-methylpropyl)amino]-3-[[3-fluoro-4-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]acetic acid |
| SMILES | CC(C)CN(c1ccc(OCC(=O)O)cc1NC(=O)Nc1ccc(C(F)(F)F)c(F)c1)C1CCCCC1 |
| InChI | InChI=1S/C26H31F4N3O4/c1-16(2)14-33(18-6-4-3-5-7-18)23-11-9-19(37-15-24(34)35)13-22(23)32-25(36)31-17-8-10-20(21(27)12-17)26(28,29)30/h8-13,16,18H,3-7,14-15H2,1-2H3,(H,34,35)(H2,31,32,36) |
| InChIKey | VINQBEJFHQSJQX-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.54 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|