C29H39FN2O4 — CID 157361275
2-[4-[cyclohexyl(2-methylpropyl)amino]-3-[[2-(2-fluoro-4-methylphenyl)acetyl]amino]phenoxy]-2-methylpropanoic acid (PubChem CID 157361275) has the molecular formula C29H39FN2O4 and a molecular weight of 498.64 g/mol. Its IUPAC name is 2-[4-[cyclohexyl(2-methylpropyl)amino]-3-[[2-(2-fluoro-4-methylphenyl)acetyl]amino]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[cyclohexyl(2-methylpropyl)amino]-3-[[2-(2-fluoro-4-methylphenyl)acetyl]amino]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 157361275 |
| Molecular Formula | C29H39FN2O4 |
| Molecular Weight | 498.64 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | 2-[4-[cyclohexyl(2-methylpropyl)amino]-3-[[2-(2-fluoro-4-methylphenyl)acetyl]amino]phenoxy]-2-methylpropanoic acid |
| SMILES | Cc1ccc(CC(=O)Nc2cc(OC(C)(C)C(=O)O)ccc2N(CC(C)C)C2CCCCC2)c(F)c1 |
| InChI | InChI=1S/C29H39FN2O4/c1-19(2)18-32(22-9-7-6-8-10-22)26-14-13-23(36-29(4,5)28(34)35)17-25(26)31-27(33)16-21-12-11-20(3)15-24(21)30/h11-15,17,19,22H,6-10,16,18H2,1-5H3,(H,31,33)(H,34,35) |
| InChIKey | MJTMNOADYKHFED-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.64 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|