C27H36F2N2O4 — CID 160797418
methyl 2-[4-[bis(2-methylpropyl)amino]-3-[[2-(2,4-difluorophenyl)acetyl]amino]phenoxy]-2-methylpropanoate (PubChem CID 160797418) has the molecular formula C27H36F2N2O4 and a molecular weight of 490.59 g/mol. Its IUPAC name is methyl 2-[4-[bis(2-methylpropyl)amino]-3-[[2-(2,4-difluorophenyl)acetyl]amino]phenoxy]-2-methylpropanoate.
| Compound Name | methyl 2-[4-[bis(2-methylpropyl)amino]-3-[[2-(2,4-difluorophenyl)acetyl]amino]phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 160797418 |
| Molecular Formula | C27H36F2N2O4 |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | methyl 2-[4-[bis(2-methylpropyl)amino]-3-[[2-(2,4-difluorophenyl)acetyl]amino]phenoxy]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)Oc1ccc(N(CC(C)C)CC(C)C)c(NC(=O)Cc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C27H36F2N2O4/c1-17(2)15-31(16-18(3)4)24-11-10-21(35-27(5,6)26(33)34-7)14-23(24)30-25(32)12-19-8-9-20(28)13-22(19)29/h8-11,13-14,17-18H,12,15-16H2,1-7H3,(H,30,32) |
| InChIKey | GBSIDVZAUGWBOK-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|