C19H30N2O4 — CID 145351258
methyl 2-[4-[bis(2-methylpropyl)amino]-3-nitrosophenoxy]-2-methylpropanoate (PubChem CID 145351258) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is methyl 2-[4-[bis(2-methylpropyl)amino]-3-nitrosophenoxy]-2-methylpropanoate.
| Compound Name | methyl 2-[4-[bis(2-methylpropyl)amino]-3-nitrosophenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 145351258 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | methyl 2-[4-[bis(2-methylpropyl)amino]-3-nitrosophenoxy]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)Oc1ccc(N(CC(C)C)CC(C)C)c(N=O)c1 |
| InChI | InChI=1S/C19H30N2O4/c1-13(2)11-21(12-14(3)4)17-9-8-15(10-16(17)20-23)25-19(5,6)18(22)24-7/h8-10,13-14H,11-12H2,1-7H3 |
| InChIKey | SOQSLHKULRFGQY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|