C25H43N3O3 — CID 145351309
2-[3-(1-aminoethylideneamino)-4-[bis(2-methylpropyl)amino]phenoxy]-2-methylpropanoic acid;2-methylbut-2-ene (PubChem CID 145351309) has the molecular formula C25H43N3O3 and a molecular weight of 433.64 g/mol. Its IUPAC name is 2-[3-(1-aminoethylideneamino)-4-[bis(2-methylpropyl)amino]phenoxy]-2-methylpropanoic acid;2-methylbut-2-ene.
| Compound Name | 2-[3-(1-aminoethylideneamino)-4-[bis(2-methylpropyl)amino]phenoxy]-2-methylpropanoic acid;2-methylbut-2-ene |
|---|---|
| PubChem CID | 145351309 |
| Molecular Formula | C25H43N3O3 |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.33 |
| IUPAC Name | 2-[3-(1-aminoethylideneamino)-4-[bis(2-methylpropyl)amino]phenoxy]-2-methylpropanoic acid;2-methylbut-2-ene |
| SMILES | C/C(N)=N\c1cc(OC(C)(C)C(=O)O)ccc1N(CC(C)C)CC(C)C.CC=C(C)C |
| InChI | InChI=1S/C20H33N3O3.C5H10/c1-13(2)11-23(12-14(3)4)18-9-8-16(10-17(18)22-15(5)21)26-20(6,7)19(24)25;1-4-5(2)3/h8-10,13-14H,11-12H2,1-7H3,(H2,21,22)(H,24,25);4H,1-3H3 |
| InChIKey | ARDKJKSBTNRDMJ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|