C26H35F2N3O4 — CID 130331254
methyl 2-[4-[bis(2-methylpropyl)amino]-3-[(2,4-difluorophenyl)carbamoylamino]phenoxy]-2-methylpropanoate (PubChem CID 130331254) has the molecular formula C26H35F2N3O4 and a molecular weight of 491.58 g/mol. Its IUPAC name is methyl 2-[4-[bis(2-methylpropyl)amino]-3-[(2,4-difluorophenyl)carbamoylamino]phenoxy]-2-methylpropanoate.
| Compound Name | methyl 2-[4-[bis(2-methylpropyl)amino]-3-[(2,4-difluorophenyl)carbamoylamino]phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 130331254 |
| Molecular Formula | C26H35F2N3O4 |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | methyl 2-[4-[bis(2-methylpropyl)amino]-3-[(2,4-difluorophenyl)carbamoylamino]phenoxy]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)Oc1ccc(N(CC(C)C)CC(C)C)c(NC(=O)Nc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C26H35F2N3O4/c1-16(2)14-31(15-17(3)4)23-11-9-19(35-26(5,6)24(32)34-7)13-22(23)30-25(33)29-21-10-8-18(27)12-20(21)28/h8-13,16-17H,14-15H2,1-7H3,(H2,29,30,33) |
| InChIKey | OXLVWVPROMXCOW-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|