C27H35F2N3O3 — CID 150474491
ethyl 3-[4-[bis(2-methylpropyl)amino]-3-[(2,4-difluorophenyl)carbamoylamino]phenyl]but-2-enoate (PubChem CID 150474491) has the molecular formula C27H35F2N3O3 and a molecular weight of 487.59 g/mol. Its IUPAC name is ethyl 3-[4-[bis(2-methylpropyl)amino]-3-[(2,4-difluorophenyl)carbamoylamino]phenyl]but-2-enoate.
| Compound Name | ethyl 3-[4-[bis(2-methylpropyl)amino]-3-[(2,4-difluorophenyl)carbamoylamino]phenyl]but-2-enoate |
|---|---|
| PubChem CID | 150474491 |
| Molecular Formula | C27H35F2N3O3 |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | ethyl 3-[4-[bis(2-methylpropyl)amino]-3-[(2,4-difluorophenyl)carbamoylamino]phenyl]but-2-enoate |
| SMILES | CCOC(=O)C=C(C)c1ccc(N(CC(C)C)CC(C)C)c(NC(=O)Nc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C27H35F2N3O3/c1-7-35-26(33)12-19(6)20-8-11-25(32(15-17(2)3)16-18(4)5)24(13-20)31-27(34)30-23-10-9-21(28)14-22(23)29/h8-14,17-18H,7,15-16H2,1-6H3,(H2,30,31,34) |
| InChIKey | HSMQPRLBJDNRJT-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|