C26H31F3N4O — CID 162610269
1-[2-[bis(2-methylpropyl)amino]-5-[(E)-1-cyanoprop-1-en-2-yl]phenyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 162610269) has the molecular formula C26H31F3N4O and a molecular weight of 472.56 g/mol. Its IUPAC name is 1-[2-[bis(2-methylpropyl)amino]-5-[(E)-1-cyanoprop-1-en-2-yl]phenyl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-[bis(2-methylpropyl)amino]-5-[(E)-1-cyanoprop-1-en-2-yl]phenyl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 162610269 |
| Molecular Formula | C26H31F3N4O |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 1-[2-[bis(2-methylpropyl)amino]-5-[(E)-1-cyanoprop-1-en-2-yl]phenyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | C/C(=C\C#N)c1ccc(N(CC(C)C)CC(C)C)c(NC(=O)Nc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C26H31F3N4O/c1-17(2)15-33(16-18(3)4)24-11-6-20(19(5)12-13-30)14-23(24)32-25(34)31-22-9-7-21(8-10-22)26(27,28)29/h6-12,14,17-18H,15-16H2,1-5H3,(H2,31,32,34)/b19-12+ |
| InChIKey | UBHBZVATVFSHIU-XDHOZWIPSA-N |
| XLogP | 7.39 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|