C19H19F2N3O3 — CID 163905035
(E)-3-[3-[(2,4-difluorophenyl)carbamoylamino]-4-(ethylamino)phenyl]but-2-enoic acid (PubChem CID 163905035) has the molecular formula C19H19F2N3O3 and a molecular weight of 375.38 g/mol. Its IUPAC name is (E)-3-[3-[(2,4-difluorophenyl)carbamoylamino]-4-(ethylamino)phenyl]but-2-enoic acid.
| Compound Name | (E)-3-[3-[(2,4-difluorophenyl)carbamoylamino]-4-(ethylamino)phenyl]but-2-enoic acid |
|---|---|
| PubChem CID | 163905035 |
| Molecular Formula | C19H19F2N3O3 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | (E)-3-[3-[(2,4-difluorophenyl)carbamoylamino]-4-(ethylamino)phenyl]but-2-enoic acid |
| SMILES | CCNc1ccc(/C(C)=C/C(=O)O)cc1NC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C19H19F2N3O3/c1-3-22-16-6-4-12(11(2)8-18(25)26)9-17(16)24-19(27)23-15-7-5-13(20)10-14(15)21/h4-10,22H,3H2,1-2H3,(H,25,26)(H2,23,24,27)/b11-8+ |
| InChIKey | QNEJJYRZYIIQFD-DHZHZOJOSA-N |
| XLogP | 4.53 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|