C25H31F2N3O3 — CID 147558885
(E)-3-[4-(dibutylamino)-3-[(2,4-difluorophenyl)carbamoylamino]phenyl]but-2-enoic acid (PubChem CID 147558885) has the molecular formula C25H31F2N3O3 and a molecular weight of 459.54 g/mol. Its IUPAC name is (E)-3-[4-(dibutylamino)-3-[(2,4-difluorophenyl)carbamoylamino]phenyl]but-2-enoic acid.
| Compound Name | (E)-3-[4-(dibutylamino)-3-[(2,4-difluorophenyl)carbamoylamino]phenyl]but-2-enoic acid |
|---|---|
| PubChem CID | 147558885 |
| Molecular Formula | C25H31F2N3O3 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | (E)-3-[4-(dibutylamino)-3-[(2,4-difluorophenyl)carbamoylamino]phenyl]but-2-enoic acid |
| SMILES | CCCCN(CCCC)c1ccc(/C(C)=C/C(=O)O)cc1NC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C25H31F2N3O3/c1-4-6-12-30(13-7-5-2)23-11-8-18(17(3)14-24(31)32)15-22(23)29-25(33)28-21-10-9-19(26)16-20(21)27/h8-11,14-16H,4-7,12-13H2,1-3H3,(H,31,32)(H2,28,29,33)/b17-14+ |
| InChIKey | FSFTVPAHLTZQEA-SAPNQHFASA-N |
| XLogP | 6.50 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|