C25H38FN7O — CID 145351307
1-[2-[bis(2-methylpropyl)amino]-5-[(1Z)-1-hydrazinyl-1-hydrazinylidenepropan-2-yl]phenyl]-3-(4-fluoro-2-methylphenyl)urea (PubChem CID 145351307) has the molecular formula C25H38FN7O and a molecular weight of 471.63 g/mol. Its IUPAC name is 1-[2-[bis(2-methylpropyl)amino]-5-[(1Z)-1-hydrazinyl-1-hydrazinylidenepropan-2-yl]phenyl]-3-(4-fluoro-2-methylphenyl)urea.
| Compound Name | 1-[2-[bis(2-methylpropyl)amino]-5-[(1Z)-1-hydrazinyl-1-hydrazinylidenepropan-2-yl]phenyl]-3-(4-fluoro-2-methylphenyl)urea |
|---|---|
| PubChem CID | 145351307 |
| Molecular Formula | C25H38FN7O |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.31 |
| IUPAC Name | 1-[2-[bis(2-methylpropyl)amino]-5-[(1Z)-1-hydrazinyl-1-hydrazinylidenepropan-2-yl]phenyl]-3-(4-fluoro-2-methylphenyl)urea |
| SMILES | Cc1cc(F)ccc1NC(=O)Nc1cc(C(C)/C(=N/N)NN)ccc1N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C25H38FN7O/c1-15(2)13-33(14-16(3)4)23-10-7-19(18(6)24(31-27)32-28)12-22(23)30-25(34)29-21-9-8-20(26)11-17(21)5/h7-12,15-16,18H,13-14,27-28H2,1-6H3,(H,31,32)(H2,29,30,34) |
| InChIKey | AVOQPVRPTYMESZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|