C27H34F2N2O3 — CID 158980755
ethyl (E)-3-[4-[bis(2-methylpropyl)amino]-3-[[2-(2,4-difluorophenyl)acetyl]amino]phenyl]prop-2-enoate (PubChem CID 158980755) has the molecular formula C27H34F2N2O3 and a molecular weight of 472.58 g/mol. Its IUPAC name is ethyl (E)-3-[4-[bis(2-methylpropyl)amino]-3-[[2-(2,4-difluorophenyl)acetyl]amino]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[bis(2-methylpropyl)amino]-3-[[2-(2,4-difluorophenyl)acetyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 158980755 |
| Molecular Formula | C27H34F2N2O3 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | ethyl (E)-3-[4-[bis(2-methylpropyl)amino]-3-[[2-(2,4-difluorophenyl)acetyl]amino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(N(CC(C)C)CC(C)C)c(NC(=O)Cc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C27H34F2N2O3/c1-6-34-27(33)12-8-20-7-11-25(31(16-18(2)3)17-19(4)5)24(13-20)30-26(32)14-21-9-10-22(28)15-23(21)29/h7-13,15,18-19H,6,14,16-17H2,1-5H3,(H,30,32)/b12-8+ |
| InChIKey | JOYWVMZSSAYSHI-XYOKQWHBSA-N |
| XLogP | 5.84 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|