C11H21NO3 — CID 115174770
methyl 2,2-dimethyl-3-[methyl(2-methylpropyl)amino]-3-oxopropanoate (PubChem CID 115174770) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-[methyl(2-methylpropyl)amino]-3-oxopropanoate.
| Compound Name | methyl 2,2-dimethyl-3-[methyl(2-methylpropyl)amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 115174770 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | methyl 2,2-dimethyl-3-[methyl(2-methylpropyl)amino]-3-oxopropanoate |
| SMILES | COC(=O)C(C)(C)C(=O)N(C)CC(C)C |
| InChI | InChI=1S/C11H21NO3/c1-8(2)7-12(5)9(13)11(3,4)10(14)15-6/h8H,7H2,1-6H3 |
| InChIKey | HWFVEQCMQDDNAL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|