About methyl 3-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-2,2-dimethylpropanoate
methyl 3-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-2,2-dimethylpropanoate (PubChem CID 79620913) has the molecular formula C14H30N2O2
and a molecular weight of 258.41 g/mol. Its IUPAC name is methyl 3-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | methyl 3-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-2,2-dimethylpropanoate |
| PubChem CID | 79620913 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | methyl 3-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)CN(CCN(C)C)CC(C)C |
| InChI | InChI=1S/C14H30N2O2/c1-12(2)10-16(9-8-15(5)6)11-14(3,4)13(17)18-7/h12H,8-11H2,1-7H3 |
| InChIKey | MYDILMGXHPNIAE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-2,2-dimethylpropanoate?
The IUPAC name of methyl 3-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-2,2-dimethylpropanoate (CID 79620913) is methyl 3-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-2,2-dimethylpropanoate.
What is the SMILES notation for methyl 3-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-2,2-dimethylpropanoate?
The canonical SMILES for methyl 3-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-2,2-dimethylpropanoate is COC(=O)C(C)(C)CN(CCN(C)C)CC(C)C.
What is the InChIKey of methyl 3-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-2,2-dimethylpropanoate?
The InChIKey is MYDILMGXHPNIAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N2O2/c1-12(2)10-16(9-8-15(5)6)11-14(3,4)13(17)18-7/h12H,8-11H2,1-7H3.
What are the key properties of methyl 3-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-2,2-dimethylpropanoate?
methyl 3-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-2,2-dimethylpropanoate has a molecular weight of 258.41 g/mol, XLogP of 1.71, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-2,2-dimethylpropanoate is sourced from PubChem (CID 79620913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).