C12H29N3O — CID 64818666
1-amino-3-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-2-methylpropan-2-ol (PubChem CID 64818666) has the molecular formula C12H29N3O and a molecular weight of 231.38 g/mol. Its IUPAC name is 1-amino-3-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-2-methylpropan-2-ol.
| Compound Name | 1-amino-3-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 64818666 |
| Molecular Formula | C12H29N3O |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.23 |
| IUPAC Name | 1-amino-3-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-2-methylpropan-2-ol |
| SMILES | CC(C)CN(CCN(C)C)CC(C)(O)CN |
| InChI | InChI=1S/C12H29N3O/c1-11(2)8-15(7-6-14(4)5)10-12(3,16)9-13/h11,16H,6-10,13H2,1-5H3 |
| InChIKey | DNOZXBBYQYRLGQ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |