C12H21BN2O4 — CID 59310885
CID 59310885 (PubChem CID 59310885) has the molecular formula C12H21BN2O4 and a molecular weight of 268.12 g/mol.
| Compound Name | CID 59310885 |
|---|---|
| PubChem CID | 59310885 |
| Molecular Formula | C12H21BN2O4 |
| Molecular Weight | 268.12 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | — |
| SMILES | [B]CN(C)C(=O)C(C)(C)NC(=O)C(C)(C)C(=O)OC |
| InChI | InChI=1S/C12H21BN2O4/c1-11(2,10(18)19-6)8(16)14-12(3,4)9(17)15(5)7-13/h7H2,1-6H3,(H,14,16) |
| InChIKey | MIFPJBLKHDKGTG-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.12 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|