C25H37BN2O5 — CID 59310763
CID 59310763 (PubChem CID 59310763) has the molecular formula C25H37BN2O5 and a molecular weight of 456.39 g/mol.
| Compound Name | CID 59310763 |
|---|---|
| PubChem CID | 59310763 |
| Molecular Formula | C25H37BN2O5 |
| Molecular Weight | 456.39 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | — |
| SMILES | [B]CN(C)C(=O)C(C)(C)NC(=O)C(C)(C)C(=O)OC(C)(C)c1ccccc1C(C)(C)C(C)=O |
| InChI | InChI=1S/C25H37BN2O5/c1-16(29)22(2,3)17-13-11-12-14-18(17)25(8,9)33-21(32)23(4,5)19(30)27-24(6,7)20(31)28(10)15-26/h11-14H,15H2,1-10H3,(H,27,30) |
| InChIKey | CDUGGOWWEKLKDR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|