About CID 59310763
CID 59310763 (PubChem CID 59310763) has the molecular formula C25H37BN2O5
and a molecular weight of 456.39 g/mol.
Molecular Properties
| Compound Name | CID 59310763 |
| PubChem CID | 59310763 |
| Molecular Formula | C25H37BN2O5 |
| Molecular Weight | 456.39 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | — |
| SMILES | [B]CN(C)C(=O)C(C)(C)NC(=O)C(C)(C)C(=O)OC(C)(C)c1ccccc1C(C)(C)C(C)=O |
| InChI | InChI=1S/C25H37BN2O5/c1-16(29)22(2,3)17-13-11-12-14-18(17)25(8,9)33-21(32)23(4,5)19(30)27-24(6,7)20(31)28(10)15-26/h11-14H,15H2,1-10H3,(H,27,30) |
| InChIKey | CDUGGOWWEKLKDR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59310763 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59310763?
The IUPAC name of CID 59310763 (CID 59310763) is not available.
What is the SMILES notation for CID 59310763?
The canonical SMILES for CID 59310763 is [B]CN(C)C(=O)C(C)(C)NC(=O)C(C)(C)C(=O)OC(C)(C)c1ccccc1C(C)(C)C(C)=O.
What is the InChIKey of CID 59310763?
The InChIKey is CDUGGOWWEKLKDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H37BN2O5/c1-16(29)22(2,3)17-13-11-12-14-18(17)25(8,9)33-21(32)23(4,5)19(30)27-24(6,7)20(31)28(10)15-26/h11-14H,15H2,1-10H3,(H,27,30).
What are the key properties of CID 59310763?
CID 59310763 has a molecular weight of 456.39 g/mol, XLogP of 2.84, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59310763 is sourced from PubChem (CID 59310763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).