C22H31BO3 — CID 58482563
CID 58482563 (PubChem CID 58482563) has the molecular formula C22H31BO3 and a molecular weight of 354.30 g/mol.
| Compound Name | CID 58482563 |
|---|---|
| PubChem CID | 58482563 |
| Molecular Formula | C22H31BO3 |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | — |
| SMILES | [B]CCC(=O)C(C)(C)C(=O)OC(C)(C)c1ccccc1C(C)(C)C(=C)C |
| InChI | InChI=1S/C22H31BO3/c1-15(2)20(3,4)16-11-9-10-12-17(16)22(7,8)26-19(25)21(5,6)18(24)13-14-23/h9-12H,1,13-14H2,2-8H3 |
| InChIKey | UNBKODRZHILDAN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|