C28H36ClFN2O4 — CID 145220988
2-[3-[3-(4-chloro-2-fluoroanilino)-3-oxopropyl]-4-[cyclohexyl(2-methylpropyl)amino]phenoxy]propanoic acid (PubChem CID 145220988) has the molecular formula C28H36ClFN2O4 and a molecular weight of 519.06 g/mol. Its IUPAC name is 2-[3-[3-(4-chloro-2-fluoroanilino)-3-oxopropyl]-4-[cyclohexyl(2-methylpropyl)amino]phenoxy]propanoic acid.
| Compound Name | 2-[3-[3-(4-chloro-2-fluoroanilino)-3-oxopropyl]-4-[cyclohexyl(2-methylpropyl)amino]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 145220988 |
| Molecular Formula | C28H36ClFN2O4 |
| Molecular Weight | 519.06 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | 2-[3-[3-(4-chloro-2-fluoroanilino)-3-oxopropyl]-4-[cyclohexyl(2-methylpropyl)amino]phenoxy]propanoic acid |
| SMILES | CC(C)CN(c1ccc(OC(C)C(=O)O)cc1CCC(=O)Nc1ccc(Cl)cc1F)C1CCCCC1 |
| InChI | InChI=1S/C28H36ClFN2O4/c1-18(2)17-32(22-7-5-4-6-8-22)26-13-11-23(36-19(3)28(34)35)15-20(26)9-14-27(33)31-25-12-10-21(29)16-24(25)30/h10-13,15-16,18-19,22H,4-9,14,17H2,1-3H3,(H,31,33)(H,34,35) |
| InChIKey | HHEYFDHENCABNM-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.06 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|