C24H29N5O3 — CID 137370580
N-[5-(morpholin-4-ylmethyl)-2-piperidin-1-ylphenyl]-5-(1H-pyrazol-4-yl)furan-2-carboxamide (PubChem CID 137370580) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is N-[5-(morpholin-4-ylmethyl)-2-piperidin-1-ylphenyl]-5-(1H-pyrazol-4-yl)furan-2-carboxamide.
| Compound Name | N-[5-(morpholin-4-ylmethyl)-2-piperidin-1-ylphenyl]-5-(1H-pyrazol-4-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 137370580 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | N-[5-(morpholin-4-ylmethyl)-2-piperidin-1-ylphenyl]-5-(1H-pyrazol-4-yl)furan-2-carboxamide |
| SMILES | O=C(Nc1cc(CN2CCOCC2)ccc1N1CCCCC1)c1ccc(-c2cn[nH]c2)o1 |
| InChI | InChI=1S/C24H29N5O3/c30-24(23-7-6-22(32-23)19-15-25-26-16-19)27-20-14-18(17-28-10-12-31-13-11-28)4-5-21(20)29-8-2-1-3-9-29/h4-7,14-16H,1-3,8-13,17H2,(H,25,26)(H,27,30) |
| InChIKey | AVIGBEMFYSWTBK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|