C22H26N6O3 — CID 137370804
N-(6-morpholin-4-yl-4-piperidin-1-yl-3-pyridinyl)-5-(1H-pyrazol-4-yl)furan-2-carboxamide (PubChem CID 137370804) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is N-(6-morpholin-4-yl-4-piperidin-1-yl-3-pyridinyl)-5-(1H-pyrazol-4-yl)furan-2-carboxamide.
| Compound Name | N-(6-morpholin-4-yl-4-piperidin-1-yl-3-pyridinyl)-5-(1H-pyrazol-4-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 137370804 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | N-(6-morpholin-4-yl-4-piperidin-1-yl-3-pyridinyl)-5-(1H-pyrazol-4-yl)furan-2-carboxamide |
| SMILES | O=C(Nc1cnc(N2CCOCC2)cc1N1CCCCC1)c1ccc(-c2cn[nH]c2)o1 |
| InChI | InChI=1S/C22H26N6O3/c29-22(20-5-4-19(31-20)16-13-24-25-14-16)26-17-15-23-21(28-8-10-30-11-9-28)12-18(17)27-6-2-1-3-7-27/h4-5,12-15H,1-3,6-11H2,(H,24,25)(H,26,29) |
| InChIKey | DMBHDNBPSNBWGD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |