C21H29BrN4O3 — CID 142511638
5-bromo-N-(6-morpholin-4-yl-4-piperidin-1-yl-3-pyridinyl)furan-2-carboxamide;ethane (PubChem CID 142511638) has the molecular formula C21H29BrN4O3 and a molecular weight of 465.39 g/mol. Its IUPAC name is 5-bromo-N-(6-morpholin-4-yl-4-piperidin-1-yl-3-pyridinyl)furan-2-carboxamide;ethane.
| Compound Name | 5-bromo-N-(6-morpholin-4-yl-4-piperidin-1-yl-3-pyridinyl)furan-2-carboxamide;ethane |
|---|---|
| PubChem CID | 142511638 |
| Molecular Formula | C21H29BrN4O3 |
| Molecular Weight | 465.39 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 5-bromo-N-(6-morpholin-4-yl-4-piperidin-1-yl-3-pyridinyl)furan-2-carboxamide;ethane |
| SMILES | CC.O=C(Nc1cnc(N2CCOCC2)cc1N1CCCCC1)c1ccc(Br)o1 |
| InChI | InChI=1S/C19H23BrN4O3.C2H6/c20-17-5-4-16(27-17)19(25)22-14-13-21-18(24-8-10-26-11-9-24)12-15(14)23-6-2-1-3-7-23;1-2/h4-5,12-13H,1-3,6-11H2,(H,22,25);1-2H3 |
| InChIKey | DWQYRMWEIVRASD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |