C21H26BrN3O3 — CID 175337810
5-bromo-N-[4-(morpholin-2-ylmethyl)-2-piperidin-1-ylphenyl]furan-2-carboxamide (PubChem CID 175337810) has the molecular formula C21H26BrN3O3 and a molecular weight of 448.36 g/mol. Its IUPAC name is 5-bromo-N-[4-(morpholin-2-ylmethyl)-2-piperidin-1-ylphenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[4-(morpholin-2-ylmethyl)-2-piperidin-1-ylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 175337810 |
| Molecular Formula | C21H26BrN3O3 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 5-bromo-N-[4-(morpholin-2-ylmethyl)-2-piperidin-1-ylphenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(CC2CNCCO2)cc1N1CCCCC1)c1ccc(Br)o1 |
| InChI | InChI=1S/C21H26BrN3O3/c22-20-7-6-19(28-20)21(26)24-17-5-4-15(12-16-14-23-8-11-27-16)13-18(17)25-9-2-1-3-10-25/h4-7,13,16,23H,1-3,8-12,14H2,(H,24,26) |
| InChIKey | XGSNGNOJJNNDFQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |