C15H30N2O3S — CID 137370714
tert-butyl 3-[(1S)-1-(tert-butylsulfinylamino)propyl]azetidine-1-carboxylate (PubChem CID 137370714) has the molecular formula C15H30N2O3S and a molecular weight of 318.48 g/mol. Its IUPAC name is tert-butyl 3-[(1S)-1-(tert-butylsulfinylamino)propyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(1S)-1-(tert-butylsulfinylamino)propyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 137370714 |
| Molecular Formula | C15H30N2O3S |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | tert-butyl 3-[(1S)-1-(tert-butylsulfinylamino)propyl]azetidine-1-carboxylate |
| SMILES | CC[C@H](NS(=O)C(C)(C)C)C1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H30N2O3S/c1-8-12(16-21(19)15(5,6)7)11-9-17(10-11)13(18)20-14(2,3)4/h11-12,16H,8-10H2,1-7H3/t12-,21?/m0/s1 |
| InChIKey | BBKGKISZPIUENH-SXWUCCAISA-N |
| XLogP | 2.68 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |