C13H10ClN3O2 — CID 137373835
6-chloro-5-[2-(2-methyl-3-oxopropyl)-1,3-oxazol-5-yl]pyridine-2-carbonitrile (PubChem CID 137373835) has the molecular formula C13H10ClN3O2 and a molecular weight of 275.70 g/mol. Its IUPAC name is 6-chloro-5-[2-(2-methyl-3-oxopropyl)-1,3-oxazol-5-yl]pyridine-2-carbonitrile.
| Compound Name | 6-chloro-5-[2-(2-methyl-3-oxopropyl)-1,3-oxazol-5-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 137373835 |
| Molecular Formula | C13H10ClN3O2 |
| Molecular Weight | 275.70 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 6-chloro-5-[2-(2-methyl-3-oxopropyl)-1,3-oxazol-5-yl]pyridine-2-carbonitrile |
| SMILES | CC(C=O)Cc1ncc(-c2ccc(C#N)nc2Cl)o1 |
| InChI | InChI=1S/C13H10ClN3O2/c1-8(7-18)4-12-16-6-11(19-12)10-3-2-9(5-15)17-13(10)14/h2-3,6-8H,4H2,1H3 |
| InChIKey | NCFACPMRKIXLOV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 79.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.70 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|